Products 143540-95-8

CAS 143540-95-8 is the registry number for 5-O-Tolyloxymethyl-4h-[1,2,4]triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-[(2-methylphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione (CAS 143540-95-8) is a chemical compound with the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. IUPAC name: 5-[(2-methylphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: OLIFRVJDHJLJOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N3OS
Molecular weight221.28 g/mol
IUPAC name5-[(2-methylphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione
InChIKeyOLIFRVJDHJLJOJ-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1OCC2=NC(=S)NN2

Computed by PubChem (NCBI)