Products 1101120-86-8
CAS 1101120-86-8 is the registry number for tert-butyl 3-acetylpyrazolo[1 ,5-a]pyridin-5- ylcarbamate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)carbamate (CAS 1101120-86-8) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: tert-butyl N-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)carbamate. InChIKey: ZJUDKAJQWPAWPJ-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | tert-butyl N-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)carbamate |
| InChIKey | ZJUDKAJQWPAWPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C=C(C=CN2N=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)