Products 1374510-85-6
CAS 1374510-85-6 is the registry number for Methyl (2z,4e)-2-(aminocarbonyl)-5-(dimethylamino)-3-pyridin-4-ylpenta-2,4-dienoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2Z,4E)-2-carbamoyl-5-(dimethylamino)-3-pyridin-4-ylpenta-2,4-dienoate (CAS 1374510-85-6) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: methyl (2Z,4E)-2-carbamoyl-5-(dimethylamino)-3-pyridin-4-ylpenta-2,4-dienoate. InChIKey: AQWBRKGEGIRPRG-SUNUYMGGSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | methyl (2Z,4E)-2-carbamoyl-5-(dimethylamino)-3-pyridin-4-ylpenta-2,4-dienoate |
| InChIKey | AQWBRKGEGIRPRG-SUNUYMGGSA-N |
| SMILES | CN(C)/C=C/C(=C(\C(=O)N)/C(=O)OC)/C1=CC=NC=C1 |
Computed by PubChem (NCBI)