Products 110220-54-7
CAS 110220-54-7 is the registry number for (S)-2,2-Dimethyl-1,3-dioxolane-4-methanol-d2. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Dideuterio-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CAS 110220-54-7) is a chemical compound with the molecular formula C6H12O3 and a molecular weight of 134.17 g/mol. IUPAC name: dideuterio-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: RNVYQYLELCKWAN-YVKXTFNSSA-N.
| Molecular formula | C6H12O3 |
|---|---|
| Molecular weight | 134.17 g/mol |
| IUPAC name | dideuterio-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | RNVYQYLELCKWAN-YVKXTFNSSA-N |
| SMILES | [2H]C([2H])([C@H]1COC(O1)(C)C)O |
Computed by PubChem (NCBI)