Products 1436560-86-9
CAS 1436560-86-9 appears in our catalog under these names: 2,2-Dimethyl-1,3-dioxolane-13C3-4-methanol, 2,2-Dimethyl-1,3-dioxolane-4-methanol-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
(2,2-dimethyl-(4,5-13C2)1,3-dioxolan-4-yl)(113C)methanol (CAS 1436560-86-9) is a chemical compound with the molecular formula C6H12O3 and a molecular weight of 135.14 g/mol. IUPAC name: (2,2-dimethyl-(4,5-13C2)1,3-dioxolan-4-yl)(113C)methanol. InChIKey: RNVYQYLELCKWAN-FRSWOAELSA-N.
| Molecular formula | C6H12O3 |
|---|---|
| Molecular weight | 135.14 g/mol |
| IUPAC name | (2,2-dimethyl-(4,5-13C2)1,3-dioxolan-4-yl)(113C)methanol |
| InChIKey | RNVYQYLELCKWAN-FRSWOAELSA-N |
| SMILES | CC1(O[13CH2][13CH](O1)[13CH2]O)C |
Computed by PubChem (NCBI)