CAS 110221-26-6 appears in our catalog under these names: (2S,6R)-6-Amino-5-oxo-2-(2-thienyl)perhydro-1,4-thiazepine, (2S,6R)–6–Amino–2–(thiophen–2–yl)–1,4–thiazepan–5–one. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg, 50mg, 1g, 250mg, 5g.
(2S,6R)-6-amino-2-thiophen-2-yl-1,4-thiazepan-5-one (CAS 110221-26-6) is a chemical compound with the molecular formula C9H12N2OS2 and a molecular weight of 228.3 g/mol. IUPAC name: (2S,6R)-6-amino-2-thiophen-2-yl-1,4-thiazepan-5-one. InChIKey: JIKPFDXBWSSTCF-XPUUQOCRSA-N.
| Molecular formula | C9H12N2OS2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | (2S,6R)-6-amino-2-thiophen-2-yl-1,4-thiazepan-5-one |
| InChIKey | JIKPFDXBWSSTCF-XPUUQOCRSA-N |
| SMILES | C1[C@H](SC[C@@H](C(=O)N1)N)C2=CC=CS2 |
Computed by PubChem (NCBI)