CAS 1860119-58-9 is the registry number for N-(2,2-Dimethylthietan-3-yl)thiazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,2-dimethylthietan-3-yl)-1,3-thiazole-4-carboxamide (CAS 1860119-58-9) is a chemical compound with the molecular formula C9H12N2OS2 and a molecular weight of 228.3 g/mol. IUPAC name: N-(2,2-dimethylthietan-3-yl)-1,3-thiazole-4-carboxamide. InChIKey: YUMRDEHSRABDEJ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2OS2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | N-(2,2-dimethylthietan-3-yl)-1,3-thiazole-4-carboxamide |
| InChIKey | YUMRDEHSRABDEJ-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC(=O)C2=CSC=N2)C |
Computed by PubChem (NCBI)