CAS 110225-28-0 is the registry number for [2-(Pentafluorophenoxy)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2,3,4,5,6-pentafluorophenoxy)ethanamine (CAS 110225-28-0) is a chemical compound with the molecular formula C8H6F5NO and a molecular weight of 227.13 g/mol. IUPAC name: 2-(2,3,4,5,6-pentafluorophenoxy)ethanamine. InChIKey: NLGUSCKEXHHEEJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F5NO |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentafluorophenoxy)ethanamine |
| InChIKey | NLGUSCKEXHHEEJ-UHFFFAOYSA-N |
| SMILES | C(COC1=C(C(=C(C(=C1F)F)F)F)F)N |
Computed by PubChem (NCBI)