Products 71791-37-2
CAS 71791-37-2 appears in our catalog under these names: 4-(Difluoromethoxy)-3-(trifluoromethyl)aniline, 95%, 4-(Difluoromethoxy)-3-(trifluoromethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(difluoromethoxy)-3-(trifluoromethyl)aniline (CAS 71791-37-2) is a chemical compound with the molecular formula C8H6F5NO and a molecular weight of 227.13 g/mol. IUPAC name: 4-(difluoromethoxy)-3-(trifluoromethyl)aniline. InChIKey: KECMHGFWHSNIEA-UHFFFAOYSA-N.
| Molecular formula | C8H6F5NO |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 4-(difluoromethoxy)-3-(trifluoromethyl)aniline |
| InChIKey | KECMHGFWHSNIEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)OC(F)F |
Computed by PubChem (NCBI)