Products 1102854-35-2

CAS 1102854-35-2 is the registry number for 1-(Pyrimidin-2-yl)piperidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

1-pyrimidin-2-ylpiperidine-2-carboxylic acid (CAS 1102854-35-2) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 1-pyrimidin-2-ylpiperidine-2-carboxylic acid. InChIKey: SKENNNIZCVLEPM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N3O2
Molecular weight207.23 g/mol
IUPAC name1-pyrimidin-2-ylpiperidine-2-carboxylic acid
InChIKeySKENNNIZCVLEPM-UHFFFAOYSA-N
SMILESC1CCN(C(C1)C(=O)O)C2=NC=CC=N2

Computed by PubChem (NCBI)