Products 1102854-98-7
CAS 1102854-98-7 is the registry number for 1-(2,4-Dimethylbenzoyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2,4-dimethylbenzoyl)pyrrolidine-2-carboxylic acid (CAS 1102854-98-7) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 1-(2,4-dimethylbenzoyl)pyrrolidine-2-carboxylic acid. InChIKey: DESAPHDWCXLBKH-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-(2,4-dimethylbenzoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | DESAPHDWCXLBKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)N2CCCC2C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
(2,4-Dimethylbenzoyl)proline