Products 1103110-91-3
CAS 1103110-91-3 is the registry number for 3-Carbamoyl-2-(2-(3-fluorophenyl)acetamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-2-[[2-(3-fluorophenyl)acetyl]amino]-4-oxobutanoic acid (CAS 1103110-91-3) is a chemical compound with the molecular formula C12H13FN2O4 and a molecular weight of 268.24 g/mol. IUPAC name: 4-amino-2-[[2-(3-fluorophenyl)acetyl]amino]-4-oxobutanoic acid. InChIKey: JGDJQZPYQSUXIA-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2O4 |
|---|---|
| Molecular weight | 268.24 g/mol |
| IUPAC name | 4-amino-2-[[2-(3-fluorophenyl)acetyl]amino]-4-oxobutanoic acid |
| InChIKey | JGDJQZPYQSUXIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)