Products 874800-66-5

CAS 874800-66-5 is the registry number for 1-(4-Fluoro-2-nitrophenyl)piperidine-3-carboxylic acid. Offered by: Fluorochem. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-fluoro-2-nitrophenyl)piperidine-3-carboxylic acid (CAS 874800-66-5) is a chemical compound with the molecular formula C12H13FN2O4 and a molecular weight of 268.24 g/mol. IUPAC name: 1-(4-fluoro-2-nitrophenyl)piperidine-3-carboxylic acid. InChIKey: PZPJVILOVXYUHU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13FN2O4
Molecular weight268.24 g/mol
IUPAC name1-(4-fluoro-2-nitrophenyl)piperidine-3-carboxylic acid
InChIKeyPZPJVILOVXYUHU-UHFFFAOYSA-N
SMILESC1CC(CN(C1)C2=C(C=C(C=C2)F)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)