CAS 1103509-33-6 is the registry number for 1-(5-Bromofuran-2-yl)-4,4-dimethylpentane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-bromofuran-2-yl)-4,4-dimethylpentane-1,3-dione (CAS 1103509-33-6) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 1-(5-bromofuran-2-yl)-4,4-dimethylpentane-1,3-dione. InChIKey: QDRMMONJMVFGMM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 1-(5-bromofuran-2-yl)-4,4-dimethylpentane-1,3-dione |
| InChIKey | QDRMMONJMVFGMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C1=CC=C(O1)Br |
Computed by PubChem (NCBI)