Products 1103527-33-8
CAS 1103527-33-8 is the registry number for (2S)-4-Methyl-2-(3,3,3-trifluoropropanamido)pentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2S)-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanoic acid (CAS 1103527-33-8) is a chemical compound with the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. IUPAC name: (2S)-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanoic acid. InChIKey: BXNBAZJAKYKNIE-LURJTMIESA-N.
| Molecular formula | C9H14F3NO3 |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | (2S)-4-methyl-2-(3,3,3-trifluoropropanoylamino)pentanoic acid |
| InChIKey | BXNBAZJAKYKNIE-LURJTMIESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CC(F)(F)F |
Computed by PubChem (NCBI)