CAS 1254036-08-2 is the registry number for 3,3-Dimethyl-1-oxa-6-azaspiro(3.3)heptane 2,2,2-trifluoroacetate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid (CAS 1254036-08-2) is a chemical compound with the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. IUPAC name: 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid. InChIKey: ANYZNWDLCIQRDJ-UHFFFAOYSA-N.
| Molecular formula | C9H14F3NO3 |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid |
| InChIKey | ANYZNWDLCIQRDJ-UHFFFAOYSA-N |
| SMILES | CC1(COC12CNC2)C.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)