CAS 1103977-07-6 appears in our catalog under these names: 1,3-Benzodioxol-5-yl(dimethylamino)acetic acid, 95%, 2-(Benzo(d)(1,3)dioxol-5-yl)-2-(dimethylamino)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)acetic acid (CAS 1103977-07-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)acetic acid. InChIKey: OYCPFYDYHYAJGQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-2-(dimethylamino)acetic acid |
| InChIKey | OYCPFYDYHYAJGQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=CC2=C(C=C1)OCO2)C(=O)O |
Computed by PubChem (NCBI)