CAS 1104483-92-2 is the registry number for N-[3-[3-(Dimethylamino)-1-oxo-2-propenyl]phenyl]-N-ethylacetamide-d3. Offered by: MedChemExpress. Available pack sizes: 2.5 mg, 5 mg.
N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-ethylacetamide (CAS 1104483-92-2) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-ethylacetamide. InChIKey: UXWJJVRASIHSQS-MDZDMXLPSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-ethylacetamide |
| InChIKey | UXWJJVRASIHSQS-MDZDMXLPSA-N |
| SMILES | CCN(C1=CC=CC(=C1)C(=O)/C=C/N(C)C)C(=O)C |
Computed by PubChem (NCBI)