CAS 1104606-57-6 appears in our catalog under these names: 3-(6-Bromo-1H-indol-3-yl)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid, 95%, 3-(6-Bromo-1H-indol-3-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 500mg.
3-(6-bromo-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1104606-57-6) is a chemical compound with the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. IUPAC name: 3-(6-bromo-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MIRGNBUFSULZAZ-UHFFFAOYSA-N.
| Molecular formula | C16H19BrN2O4 |
|---|---|
| Molecular weight | 383.24 g/mol |
| IUPAC name | 3-(6-bromo-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MIRGNBUFSULZAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CNC2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)