CAS 612484-55-6 appears in our catalog under these names: (S)-3-(7-Bromo-1H-indol-3-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 97%, 97%, Boc-Trp(7-Br)-OH, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2S)-3-(7-bromo-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 612484-55-6) is a chemical compound with the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. IUPAC name: (2S)-3-(7-bromo-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: XQVLODKGIHVFTP-LBPRGKRZSA-N.
| Molecular formula | C16H19BrN2O4 |
|---|---|
| Molecular weight | 383.24 g/mol |
| IUPAC name | (2S)-3-(7-bromo-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | XQVLODKGIHVFTP-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CNC2=C1C=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)