CAS 1104637-06-0 is the registry number for 5-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde (CAS 1104637-06-0) is a chemical compound with the molecular formula C10H10BNO5S and a molecular weight of 267.07 g/mol. IUPAC name: 5-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde. InChIKey: MXOPPZMPYPCZND-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO5S |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 5-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde |
| InChIKey | MXOPPZMPYPCZND-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(S2)C=O |
Computed by PubChem (NCBI)