CAS 1309677-06-2 is the registry number for 5–(6–Methyl–4,8–dioxo–1,3,6,2–dioxazaborocan–2–yl)thiophene–2–carbaldehyde. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
5-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde (CAS 1309677-06-2) is a chemical compound with the molecular formula C10H10BNO5S and a molecular weight of 267.07 g/mol. IUPAC name: 5-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde. InChIKey: MXOPPZMPYPCZND-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO5S |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 5-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)thiophene-2-carbaldehyde |
| InChIKey | MXOPPZMPYPCZND-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(S2)C=O |
Computed by PubChem (NCBI)