Products 1104784-04-4
CAS 1104784-04-4 is the registry number for 1-(2,4,6-Trimethylbenzoyl)piperidine-2-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid (CAS 1104784-04-4) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: 1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid. InChIKey: BIWCNACETKELBG-UHFFFAOYSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | 1-(2,4,6-trimethylbenzoyl)piperidine-2-carboxylic acid |
| InChIKey | BIWCNACETKELBG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)N2CCCCC2C(=O)O)C |
Computed by PubChem (NCBI)