CAS 1105054-66-7 appears in our catalog under these names: 2,3,5-Tri-o-benzyl-beta-d-xylofuranose, 95%, 2,3,5–Tris–O–(phenylmethyl)–β–D–xylofuranose. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
(2R,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol (CAS 1105054-66-7) is a chemical compound with the molecular formula C26H28O5 and a molecular weight of 420.5 g/mol. IUPAC name: (2R,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol. InChIKey: NAQUAXSCBJPECG-XDZVQPMWSA-N.
| Molecular formula | C26H28O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | (2R,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
| InChIKey | NAQUAXSCBJPECG-XDZVQPMWSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@@H]([C@H]([C@@H](O2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)