Products 135791-05-8
CAS 135791-05-8 is the registry number for 2,3,5-Tri-O-benzyl-L-xylofuranose. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
(3S,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol (CAS 135791-05-8) is a chemical compound with the molecular formula C26H28O5 and a molecular weight of 420.5 g/mol. IUPAC name: (3S,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol. InChIKey: NAQUAXSCBJPECG-XMBLLSNASA-N.
| Molecular formula | C26H28O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | (3S,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
| InChIKey | NAQUAXSCBJPECG-XMBLLSNASA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H]2[C@H]([C@@H](C(O2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)