CAS 11051-88-0 appears in our catalog under these names: Cochliodinol, Cochliodinol, ≥95%, ≥95%. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, Get quote.
2,5-dihydroxy-3,6-bis[5-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione (CAS 11051-88-0) is a chemical compound with the molecular formula C32H30N2O4 and a molecular weight of 506.6 g/mol. IUPAC name: 2,5-dihydroxy-3,6-bis[5-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione. InChIKey: ZXRULNXZJSCTQQ-UHFFFAOYSA-N.
| Molecular formula | C32H30N2O4 |
|---|---|
| Molecular weight | 506.6 g/mol |
| IUPAC name | 2,5-dihydroxy-3,6-bis[5-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| InChIKey | ZXRULNXZJSCTQQ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC2=C(C=C1)NC=C2C3=C(C(=O)C(=C(C3=O)O)C4=CNC5=C4C=C(C=C5)CC=C(C)C)O)C |
Computed by PubChem (NCBI)