Products 150881-02-0
CAS 150881-02-0 is the registry number for Aurantiamide benzoate. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
[(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-3-phenylpropyl] benzoate (CAS 150881-02-0) is a chemical compound with the molecular formula C32H30N2O4 and a molecular weight of 506.6 g/mol. IUPAC name: [(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-3-phenylpropyl] benzoate. InChIKey: WJJGUIYRXBJSMQ-VMPREFPWSA-N.
| Molecular formula | C32H30N2O4 |
|---|---|
| Molecular weight | 506.6 g/mol |
| IUPAC name | [(2S)-2-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-3-phenylpropyl] benzoate |
| InChIKey | WJJGUIYRXBJSMQ-VMPREFPWSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](COC(=O)C2=CC=CC=C2)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)