CAS 1105189-48-7 is the registry number for 5-Amino-1-tert-butyl-1,5-dihydro-4h-pyrazolo(3,4-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
5-amino-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one (CAS 1105189-48-7) is a chemical compound with the molecular formula C9H13N5O and a molecular weight of 207.23 g/mol. IUPAC name: 5-amino-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one. InChIKey: PZAJUOTWFKOSCD-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 5-amino-1-tert-butylpyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | PZAJUOTWFKOSCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=O)N(C=N2)N |
Computed by PubChem (NCBI)