CAS 901250-28-0 is the registry number for 6-Amino-5-methyl-2-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-5-methyl-2-propyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 901250-28-0) is a chemical compound with the molecular formula C9H13N5O and a molecular weight of 207.23 g/mol. IUPAC name: 6-amino-5-methyl-2-propyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: XNBFZTLFDKKGOE-UHFFFAOYSA-N.
| Molecular formula | C9H13N5O |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 6-amino-5-methyl-2-propyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | XNBFZTLFDKKGOE-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=NC(=C(C(=O)N2N1)N)C |
Computed by PubChem (NCBI)