CAS 1105196-55-1 is the registry number for 1-(4-Fluorophenyl)-4-isopropyl-1,6-dihydro-7H-pyrazolo[3,4-d]pyridazin-7-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-fluorophenyl)-4-propan-2-yl-6H-pyrazolo[4,5-d]pyridazin-7-one (CAS 1105196-55-1) is a chemical compound with the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-propan-2-yl-6H-pyrazolo[4,5-d]pyridazin-7-one. InChIKey: DCYMIIOQZFSCFC-UHFFFAOYSA-N.
| Molecular formula | C14H13FN4O |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-propan-2-yl-6H-pyrazolo[4,5-d]pyridazin-7-one |
| InChIKey | DCYMIIOQZFSCFC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NNC(=O)C2=C1C=NN2C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)