Products 31271-94-0
CAS 31271-94-0 is the registry number for 8-Demethyl Zolazepam. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2,5mg, 25mg, 5mg, 2mg, 50mg.
4-(2-fluorophenyl)-1,3-dimethyl-6,8-dihydropyrazolo[5,4-e][1,4]diazepin-7-one (CAS 31271-94-0) is a chemical compound with the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. IUPAC name: 4-(2-fluorophenyl)-1,3-dimethyl-6,8-dihydropyrazolo[5,4-e][1,4]diazepin-7-one. InChIKey: JYDBGASQSWODLH-UHFFFAOYSA-N.
| Molecular formula | C14H13FN4O |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1,3-dimethyl-6,8-dihydropyrazolo[5,4-e][1,4]diazepin-7-one |
| InChIKey | JYDBGASQSWODLH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NCC(=O)N2)C3=CC=CC=C3F)C |
Computed by PubChem (NCBI)