CAS 110675-48-4 is the registry number for Ro 14-6113. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol (CAS 110675-48-4) is a chemical compound with the molecular formula C23H28O and a molecular weight of 320.5 g/mol. IUPAC name: 4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol. InChIKey: CIECIINGNIMHEN-JQIJEIRASA-N.
| Molecular formula | C23H28O |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | 4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenol |
| InChIKey | CIECIINGNIMHEN-JQIJEIRASA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)O)/C2=CC3=C(C=C2)C(CCC3(C)C)(C)C |
Computed by PubChem (NCBI)