CAS 1107654-26-1 is the registry number for 4-Chloro-N-(4-chlorophenyl)-1,3,5-triazin-2-amine. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
4-chloro-N-(4-chlorophenyl)-1,3,5-triazin-2-amine (CAS 1107654-26-1) is a chemical compound with the molecular formula C9H6Cl2N4 and a molecular weight of 241.07 g/mol. IUPAC name: 4-chloro-N-(4-chlorophenyl)-1,3,5-triazin-2-amine. InChIKey: AVEWCFDNNDQJAC-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N4 |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 4-chloro-N-(4-chlorophenyl)-1,3,5-triazin-2-amine |
| InChIKey | AVEWCFDNNDQJAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)