CAS 2272-40-4 appears in our catalog under these names: 4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine, 4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine 98%, 4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine, 98%, 98%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine (CAS 2272-40-4) is a chemical compound with the molecular formula C9H6Cl2N4 and a molecular weight of 241.07 g/mol. IUPAC name: 4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine. InChIKey: SACFASUHQGNXOD-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N4 |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine |
| InChIKey | SACFASUHQGNXOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)