CAS 1107694-72-3 is the registry number for 2-Benzamido-5-bromo-[1,3]thiazolo[5,4-b]pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)benzamide (CAS 1107694-72-3) is a chemical compound with the molecular formula C13H8BrN3OS and a molecular weight of 334.19 g/mol. IUPAC name: N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)benzamide. InChIKey: NLYDSXYSVWSSSI-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN3OS |
|---|---|
| Molecular weight | 334.19 g/mol |
| IUPAC name | N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)benzamide |
| InChIKey | NLYDSXYSVWSSSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=NC3=C(S2)N=C(C=C3)Br |
Computed by PubChem (NCBI)