CAS 2273883-61-5 is the registry number for N-(7-Bromothiazolo[4,5-c]pyridin-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(7-bromo-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide (CAS 2273883-61-5) is a chemical compound with the molecular formula C13H8BrN3OS and a molecular weight of 334.19 g/mol. IUPAC name: N-(7-bromo-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide. InChIKey: ZCNFEFQQLMVMQE-UHFFFAOYSA-N.
| Molecular formula | C13H8BrN3OS |
|---|---|
| Molecular weight | 334.19 g/mol |
| IUPAC name | N-(7-bromo-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide |
| InChIKey | ZCNFEFQQLMVMQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=NC3=CN=CC(=C3S2)Br |
Computed by PubChem (NCBI)