CAS 110798-13-5 appears in our catalog under these names: D-homoarginine, D-HOMOARGININE, 98%, 98%, H-D-HoArg-OH, 98%. Offered by: Chemat Brand, Chemat, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g.
(2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid (CAS 110798-13-5) is a chemical compound with the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. IUPAC name: (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid. InChIKey: QUOGESRFPZDMMT-RXMQYKEDSA-N.
| Molecular formula | C7H16N4O2 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid |
| InChIKey | QUOGESRFPZDMMT-RXMQYKEDSA-N |
| SMILES | C(CCN=C(N)N)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)