Products 1332075-41-8
CAS 1332075-41-8 is the registry number for H-HoArg-OH-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2S)-2-amino-4,4,5,5-tetradeuterio-6-(diaminomethylideneamino)hexanoic acid (CAS 1332075-41-8) is a chemical compound with the molecular formula C7H16N4O2 and a molecular weight of 192.25 g/mol. IUPAC name: (2S)-2-amino-4,4,5,5-tetradeuterio-6-(diaminomethylideneamino)hexanoic acid. InChIKey: QUOGESRFPZDMMT-OZDFLOAESA-N.
| Molecular formula | C7H16N4O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | (2S)-2-amino-4,4,5,5-tetradeuterio-6-(diaminomethylideneamino)hexanoic acid |
| InChIKey | QUOGESRFPZDMMT-OZDFLOAESA-N |
| SMILES | [2H]C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])CN=C(N)N |
Computed by PubChem (NCBI)