Products 1108175-74-1
CAS 1108175-74-1 is the registry number for Ethyl 7-Fluoro-4-nitroindole-2-carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 7-fluoro-4-nitro-1H-indole-2-carboxylate (CAS 1108175-74-1) is a chemical compound with the molecular formula C11H9FN2O4 and a molecular weight of 252.20 g/mol. IUPAC name: ethyl 7-fluoro-4-nitro-1H-indole-2-carboxylate. InChIKey: HVTKSLJADXODCS-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O4 |
|---|---|
| Molecular weight | 252.20 g/mol |
| IUPAC name | ethyl 7-fluoro-4-nitro-1H-indole-2-carboxylate |
| InChIKey | HVTKSLJADXODCS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2N1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)