Products 1109218-03-2
CAS 1109218-03-2 is the registry number for (-)-O-Desmethyl Tramadol-d6. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
3-[(1S,2S)-2-[[bis(trideuteriomethyl)amino]methyl]-1-hydroxycyclohexyl]phenol (CAS 1109218-03-2) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 255.38 g/mol. IUPAC name: 3-[(1S,2S)-2-[[bis(trideuteriomethyl)amino]methyl]-1-hydroxycyclohexyl]phenol. InChIKey: UWJUQVWARXYRCG-RJSIYLOFSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 255.38 g/mol |
| IUPAC name | 3-[(1S,2S)-2-[[bis(trideuteriomethyl)amino]methyl]-1-hydroxycyclohexyl]phenol |
| InChIKey | UWJUQVWARXYRCG-RJSIYLOFSA-N |
| SMILES | [2H]C([2H])([2H])N(C[C@@H]1CCCC[C@]1(C2=CC(=CC=C2)O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)