Products 873928-73-5
CAS 873928-73-5 appears in our catalog under these names: O-Desmethyl Tramadol-d6, >95% (HPLC), (±)-(Cis)-o-desmethyltramadol-d6 (N,N-di(methyl-d3)), O-Desmethyl Tramadol-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 10 mg, 25 mg.
3-[(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-hydroxycyclohexyl]phenol (CAS 873928-73-5) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 255.38 g/mol. IUPAC name: 3-[(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-hydroxycyclohexyl]phenol. InChIKey: UWJUQVWARXYRCG-BMJHUOGNSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 255.38 g/mol |
| IUPAC name | 3-[(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-hydroxycyclohexyl]phenol |
| InChIKey | UWJUQVWARXYRCG-BMJHUOGNSA-N |
| SMILES | [2H]C([2H])([2H])N(C[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)