CAS 1109277-67-9 is the registry number for Methyl 2-(4-(((trifluoromethyl)sulfonyl)oxy)cyclohex-3-en-1-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]acetate (CAS 1109277-67-9) is a chemical compound with the molecular formula C10H13F3O5S and a molecular weight of 302.27 g/mol. IUPAC name: methyl 2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]acetate. InChIKey: CGZCGKJTNDDTBD-UHFFFAOYSA-N.
| Molecular formula | C10H13F3O5S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | methyl 2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]acetate |
| InChIKey | CGZCGKJTNDDTBD-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CCC(=CC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)