CAS 122948-57-6 is the registry number for Ethyl 4-(((trifluoromethyl)sulfonyl)oxy)cyclohex-3-enecarboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
Ethyl 4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate (CAS 122948-57-6) is a chemical compound with the molecular formula C10H13F3O5S and a molecular weight of 302.27 g/mol. IUPAC name: ethyl 4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate. InChIKey: FKPYEDFRKMRJBL-UHFFFAOYSA-N.
| Molecular formula | C10H13F3O5S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | ethyl 4-(trifluoromethylsulfonyloxy)cyclohex-3-ene-1-carboxylate |
| InChIKey | FKPYEDFRKMRJBL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(=CC1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)