CAS 1109284-41-4 is the registry number for tert-Butyl ((1R,2S)-3,3-difluoro-2-hydroxycyclohexyl)carbamate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate (CAS 1109284-41-4) is a chemical compound with the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. IUPAC name: tert-butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate. InChIKey: WGGHBJFYNGGDHJ-SFYZADRCSA-N.
| Molecular formula | C11H19F2NO3 |
|---|---|
| Molecular weight | 251.27 g/mol |
| IUPAC name | tert-butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate |
| InChIKey | WGGHBJFYNGGDHJ-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC([C@H]1O)(F)F |
Computed by PubChem (NCBI)