Products 2940859-11-8
CAS 2940859-11-8 is the registry number for tert-butyl N-[trans-4,4-difluoro-2-hydroxy-cyclohexyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[(1R,2R)-4,4-difluoro-2-hydroxycyclohexyl]carbamate (CAS 2940859-11-8) is a chemical compound with the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-4,4-difluoro-2-hydroxycyclohexyl]carbamate. InChIKey: SDVYTQJAIGCEAE-HTQZYQBOSA-N.
| Molecular formula | C11H19F2NO3 |
|---|---|
| Molecular weight | 251.27 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-4,4-difluoro-2-hydroxycyclohexyl]carbamate |
| InChIKey | SDVYTQJAIGCEAE-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC(C[C@H]1O)(F)F |
Computed by PubChem (NCBI)