CAS 111005-65-3 appears in our catalog under these names: (3A'R,6a'R)-3a',6a'-dihydro-4'H-spiro[cyclohexane-1,2'-cyclopenta[d][1,3]dioxol]-4'-one, 98%, (1R,2R)-1,2-Dihydroxy-3-cyclopropen-5-one 1,2-Cyclohexyl Ketal, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
(3aR,6aR)-spiro[3a,6a-dihydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one (CAS 111005-65-3) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: (3aR,6aR)-spiro[3a,6a-dihydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one. InChIKey: LQYQJRFUFQAQRI-ZJUUUORDSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | (3aR,6aR)-spiro[3a,6a-dihydrocyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-4-one |
| InChIKey | LQYQJRFUFQAQRI-ZJUUUORDSA-N |
| SMILES | C1CCC2(CC1)O[C@@H]3C=CC(=O)[C@@H]3O2 |
Computed by PubChem (NCBI)