CAS 111073-18-8 is the registry number for Nemazoline (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline;hydrochloride (CAS 111073-18-8) is a chemical compound with the molecular formula C10H12Cl3N3 and a molecular weight of 280.6 g/mol. IUPAC name: 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline;hydrochloride. InChIKey: ASIGTNNPGBMHLP-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N3 |
|---|---|
| Molecular weight | 280.6 g/mol |
| IUPAC name | 2,6-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline;hydrochloride |
| InChIKey | ASIGTNNPGBMHLP-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)CC2=CC(=C(C(=C2)Cl)N)Cl.Cl |
Computed by PubChem (NCBI)