CAS 1181458-62-7 is the registry number for 3-Chloro-2-(2-methyl-1H-imidazol-1-yl)aniline dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-chloro-2-(2-methylimidazol-1-yl)aniline;dihydrochloride (CAS 1181458-62-7) is a chemical compound with the molecular formula C10H12Cl3N3 and a molecular weight of 280.6 g/mol. IUPAC name: 3-chloro-2-(2-methylimidazol-1-yl)aniline;dihydrochloride. InChIKey: VIOSZOAOENZKMR-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N3 |
|---|---|
| Molecular weight | 280.6 g/mol |
| IUPAC name | 3-chloro-2-(2-methylimidazol-1-yl)aniline;dihydrochloride |
| InChIKey | VIOSZOAOENZKMR-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1C2=C(C=CC=C2Cl)N.Cl.Cl |
Computed by PubChem (NCBI)