CAS 1110762-81-6 is the registry number for 4-Chloro-n-(2-methoxybenzyl)-3-sulfamoylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-N-[(2-methoxyphenyl)methyl]-3-sulfamoylbenzamide (CAS 1110762-81-6) is a chemical compound with the molecular formula C15H15ClN2O4S and a molecular weight of 354.8 g/mol. IUPAC name: 4-chloro-N-[(2-methoxyphenyl)methyl]-3-sulfamoylbenzamide. InChIKey: APRSKRYDDCWHTK-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O4S |
|---|---|
| Molecular weight | 354.8 g/mol |
| IUPAC name | 4-chloro-N-[(2-methoxyphenyl)methyl]-3-sulfamoylbenzamide |
| InChIKey | APRSKRYDDCWHTK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1CNC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)