CAS 1330262-09-3 appears in our catalog under these names: Xipamide-d6, Xipamide-d6, >95% (HPLC). Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg, 10 mg.
N-[2,6-bis(trideuteriomethyl)phenyl]-4-chloro-2-hydroxy-5-sulfamoylbenzamide (CAS 1330262-09-3) is a chemical compound with the molecular formula C15H15ClN2O4S and a molecular weight of 360.8 g/mol. IUPAC name: N-[2,6-bis(trideuteriomethyl)phenyl]-4-chloro-2-hydroxy-5-sulfamoylbenzamide. InChIKey: MTZBBNMLMNBNJL-WFGJKAKNSA-N.
| Molecular formula | C15H15ClN2O4S |
|---|---|
| Molecular weight | 360.8 g/mol |
| IUPAC name | N-[2,6-bis(trideuteriomethyl)phenyl]-4-chloro-2-hydroxy-5-sulfamoylbenzamide |
| InChIKey | MTZBBNMLMNBNJL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])NC(=O)C2=CC(=C(C=C2O)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)